About 3-[1-(2,6-dimethylphenyl)tetrazol-5-yl]sulfanylazepan-2-one
3-[1-(2,6-dimethylphenyl)tetrazol-5-yl]sulfanylazepan-2-one (PubChem CID 42894818) has the molecular formula C15H19N5OS
and a molecular weight of 317.42 g/mol. Its IUPAC name is 3-[1-(2,6-dimethylphenyl)tetrazol-5-yl]sulfanylazepan-2-one.
Molecular Properties
| Compound Name | 3-[1-(2,6-dimethylphenyl)tetrazol-5-yl]sulfanylazepan-2-one |
| PubChem CID | 42894818 |
| Molecular Formula | C15H19N5OS |
| Molecular Weight | 317.42 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 3-[1-(2,6-dimethylphenyl)tetrazol-5-yl]sulfanylazepan-2-one |
| SMILES | Cc1cccc(C)c1-n1nnnc1SC1CCCCNC1=O |
| InChI | InChI=1S/C15H19N5OS/c1-10-6-5-7-11(2)13(10)20-15(17-18-19-20)22-12-8-3-4-9-16-14(12)21/h5-7,12H,3-4,8-9H2,1-2H3,(H,16,21) |
| InChIKey | DDPBBZPYIZUHMQ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.42 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[1-(2,6-dimethylphenyl)tetrazol-5-yl]sulfanylazepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-(2,6-dimethylphenyl)tetrazol-5-yl]sulfanylazepan-2-one?
The IUPAC name of 3-[1-(2,6-dimethylphenyl)tetrazol-5-yl]sulfanylazepan-2-one (CID 42894818) is 3-[1-(2,6-dimethylphenyl)tetrazol-5-yl]sulfanylazepan-2-one.
What is the SMILES notation for 3-[1-(2,6-dimethylphenyl)tetrazol-5-yl]sulfanylazepan-2-one?
The canonical SMILES for 3-[1-(2,6-dimethylphenyl)tetrazol-5-yl]sulfanylazepan-2-one is Cc1cccc(C)c1-n1nnnc1SC1CCCCNC1=O.
What is the InChIKey of 3-[1-(2,6-dimethylphenyl)tetrazol-5-yl]sulfanylazepan-2-one?
The InChIKey is DDPBBZPYIZUHMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N5OS/c1-10-6-5-7-11(2)13(10)20-15(17-18-19-20)22-12-8-3-4-9-16-14(12)21/h5-7,12H,3-4,8-9H2,1-2H3,(H,16,21).
What are the key properties of 3-[1-(2,6-dimethylphenyl)tetrazol-5-yl]sulfanylazepan-2-one?
3-[1-(2,6-dimethylphenyl)tetrazol-5-yl]sulfanylazepan-2-one has a molecular weight of 317.42 g/mol, XLogP of 2.04, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(2,6-dimethylphenyl)tetrazol-5-yl]sulfanylazepan-2-one is sourced from PubChem (CID 42894818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).