About (7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 5-(hydroxymethyl)-2-methylfuran-3-carboxylate
(7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 5-(hydroxymethyl)-2-methylfuran-3-carboxylate (PubChem CID 42894982) has the molecular formula C16H13ClN2O5
and a molecular weight of 348.74 g/mol. Its IUPAC name is (7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 5-(hydroxymethyl)-2-methylfuran-3-carboxylate.
Molecular Properties
| Compound Name | (7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 5-(hydroxymethyl)-2-methylfuran-3-carboxylate |
| PubChem CID | 42894982 |
| Molecular Formula | C16H13ClN2O5 |
| Molecular Weight | 348.74 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | (7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 5-(hydroxymethyl)-2-methylfuran-3-carboxylate |
| SMILES | Cc1oc(CO)cc1C(=O)OCc1cc(=O)n2cc(Cl)ccc2n1 |
| InChI | InChI=1S/C16H13ClN2O5/c1-9-13(5-12(7-20)24-9)16(22)23-8-11-4-15(21)19-6-10(17)2-3-14(19)18-11/h2-6,20H,7-8H2,1H3 |
| InChIKey | FFOJHWLHFHPZTJ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.74 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 5-(hydroxymethyl)-2-methylfuran-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 5-(hydroxymethyl)-2-methylfuran-3-carboxylate?
The IUPAC name of (7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 5-(hydroxymethyl)-2-methylfuran-3-carboxylate (CID 42894982) is (7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 5-(hydroxymethyl)-2-methylfuran-3-carboxylate.
What is the SMILES notation for (7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 5-(hydroxymethyl)-2-methylfuran-3-carboxylate?
The canonical SMILES for (7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 5-(hydroxymethyl)-2-methylfuran-3-carboxylate is Cc1oc(CO)cc1C(=O)OCc1cc(=O)n2cc(Cl)ccc2n1.
What is the InChIKey of (7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 5-(hydroxymethyl)-2-methylfuran-3-carboxylate?
The InChIKey is FFOJHWLHFHPZTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13ClN2O5/c1-9-13(5-12(7-20)24-9)16(22)23-8-11-4-15(21)19-6-10(17)2-3-14(19)18-11/h2-6,20H,7-8H2,1H3.
What are the key properties of (7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 5-(hydroxymethyl)-2-methylfuran-3-carboxylate?
(7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 5-(hydroxymethyl)-2-methylfuran-3-carboxylate has a molecular weight of 348.74 g/mol, XLogP of 2.10, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (7-chloro-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 5-(hydroxymethyl)-2-methylfuran-3-carboxylate is sourced from PubChem (CID 42894982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).