C15H17N5O2S — CID 42895998
1-[2-[4-(methylamino)quinazolin-2-yl]sulfanylpropanoyl]imidazolidin-2-one (PubChem CID 42895998) has the molecular formula C15H17N5O2S and a molecular weight of 331.40 g/mol. Its IUPAC name is 1-[2-[4-(methylamino)quinazolin-2-yl]sulfanylpropanoyl]imidazolidin-2-one.
| Compound Name | 1-[2-[4-(methylamino)quinazolin-2-yl]sulfanylpropanoyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 42895998 |
| Molecular Formula | C15H17N5O2S |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 1-[2-[4-(methylamino)quinazolin-2-yl]sulfanylpropanoyl]imidazolidin-2-one |
| SMILES | CNc1nc(SC(C)C(=O)N2CCNC2=O)nc2ccccc12 |
| InChI | InChI=1S/C15H17N5O2S/c1-9(13(21)20-8-7-17-15(20)22)23-14-18-11-6-4-3-5-10(11)12(16-2)19-14/h3-6,9H,7-8H2,1-2H3,(H,17,22)(H,16,18,19) |
| InChIKey | OQCIUMWDMSNZHK-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |