C15H18N2O6 — CID 42896084
3-[3-(1,3-benzodioxol-5-ylmethoxy)-2-hydroxypropyl]-1-methylimidazolidine-2,4-dione (PubChem CID 42896084) has the molecular formula C15H18N2O6 and a molecular weight of 322.32 g/mol. Its IUPAC name is 3-[3-(1,3-benzodioxol-5-ylmethoxy)-2-hydroxypropyl]-1-methylimidazolidine-2,4-dione.
| Compound Name | 3-[3-(1,3-benzodioxol-5-ylmethoxy)-2-hydroxypropyl]-1-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 42896084 |
| Molecular Formula | C15H18N2O6 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 3-[3-(1,3-benzodioxol-5-ylmethoxy)-2-hydroxypropyl]-1-methylimidazolidine-2,4-dione |
| SMILES | CN1CC(=O)N(CC(O)COCc2ccc3c(c2)OCO3)C1=O |
| InChI | InChI=1S/C15H18N2O6/c1-16-6-14(19)17(15(16)20)5-11(18)8-21-7-10-2-3-12-13(4-10)23-9-22-12/h2-4,11,18H,5-9H2,1H3 |
| InChIKey | WSSJAHBGNZBNRZ-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|