C17H15NO3S2 — CID 42896613
oxolan-2-ylmethyl 5-(1,3-benzothiazol-2-yl)thiophene-2-carboxylate (PubChem CID 42896613) has the molecular formula C17H15NO3S2 and a molecular weight of 345.44 g/mol. Its IUPAC name is oxolan-2-ylmethyl 5-(1,3-benzothiazol-2-yl)thiophene-2-carboxylate.
| Compound Name | oxolan-2-ylmethyl 5-(1,3-benzothiazol-2-yl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 42896613 |
| Molecular Formula | C17H15NO3S2 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | oxolan-2-ylmethyl 5-(1,3-benzothiazol-2-yl)thiophene-2-carboxylate |
| SMILES | O=C(OCC1CCCO1)c1ccc(-c2nc3ccccc3s2)s1 |
| InChI | InChI=1S/C17H15NO3S2/c19-17(21-10-11-4-3-9-20-11)15-8-7-14(22-15)16-18-12-5-1-2-6-13(12)23-16/h1-2,5-8,11H,3-4,9-10H2 |
| InChIKey | SMMVUCWGGFWJSW-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |