C23H24N6O2S — CID 42896634
4-methyl-5-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)pyrrolidine-1-carbonyl]-6-thia-1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-trien-2-one (PubChem CID 42896634) has the molecular formula C23H24N6O2S and a molecular weight of 448.55 g/mol. Its IUPAC name is 4-methyl-5-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)pyrrolidine-1-carbonyl]-6-thia-1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-trien-2-one.
| Compound Name | 4-methyl-5-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)pyrrolidine-1-carbonyl]-6-thia-1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-trien-2-one |
|---|---|
| PubChem CID | 42896634 |
| Molecular Formula | C23H24N6O2S |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | 4-methyl-5-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)pyrrolidine-1-carbonyl]-6-thia-1,8-diazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-trien-2-one |
| SMILES | Cc1c(C(=O)N2CCCC2c2nnc3ccccn23)sc2nc3n(c(=O)c12)CCCCC3 |
| InChI | InChI=1S/C23H24N6O2S/c1-14-18-21(24-16-9-3-2-5-12-29(16)22(18)30)32-19(14)23(31)27-13-7-8-15(27)20-26-25-17-10-4-6-11-28(17)20/h4,6,10-11,15H,2-3,5,7-9,12-13H2,1H3 |
| InChIKey | RSGWPGOBKOUKGP-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 85.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |