About 5-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylmethyl]-1,3-oxazolidin-2-one
5-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylmethyl]-1,3-oxazolidin-2-one (PubChem CID 42896643) has the molecular formula C16H13N3O2S2
and a molecular weight of 343.43 g/mol. Its IUPAC name is 5-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylmethyl]-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 5-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylmethyl]-1,3-oxazolidin-2-one |
| PubChem CID | 42896643 |
| Molecular Formula | C16H13N3O2S2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | 5-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylmethyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1NCC(CSc2ncnc3sc(-c4ccccc4)cc23)O1 |
| InChI | InChI=1S/C16H13N3O2S2/c20-16-17-7-11(21-16)8-22-14-12-6-13(10-4-2-1-3-5-10)23-15(12)19-9-18-14/h1-6,9,11H,7-8H2,(H,17,20) |
| InChIKey | GEAXIWFIFPCAKB-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylmethyl]-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylmethyl]-1,3-oxazolidin-2-one?
The IUPAC name of 5-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylmethyl]-1,3-oxazolidin-2-one (CID 42896643) is 5-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylmethyl]-1,3-oxazolidin-2-one.
What is the SMILES notation for 5-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylmethyl]-1,3-oxazolidin-2-one?
The canonical SMILES for 5-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylmethyl]-1,3-oxazolidin-2-one is O=C1NCC(CSc2ncnc3sc(-c4ccccc4)cc23)O1.
What is the InChIKey of 5-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylmethyl]-1,3-oxazolidin-2-one?
The InChIKey is GEAXIWFIFPCAKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13N3O2S2/c20-16-17-7-11(21-16)8-22-14-12-6-13(10-4-2-1-3-5-10)23-15(12)19-9-18-14/h1-6,9,11H,7-8H2,(H,17,20).
What are the key properties of 5-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylmethyl]-1,3-oxazolidin-2-one?
5-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylmethyl]-1,3-oxazolidin-2-one has a molecular weight of 343.43 g/mol, XLogP of 3.56, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(6-phenylthieno[2,3-d]pyrimidin-4-yl)sulfanylmethyl]-1,3-oxazolidin-2-one is sourced from PubChem (CID 42896643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).