C36H45N3O3 — CID 4289842
2,4,6-tris(4-tert-butyl-2-methylphenoxy)-1,3,5-triazine (PubChem CID 4289842) has the molecular formula C36H45N3O3 and a molecular weight of 567.77 g/mol. Its IUPAC name is 2,4,6-tris(4-tert-butyl-2-methylphenoxy)-1,3,5-triazine.
| Compound Name | 2,4,6-tris(4-tert-butyl-2-methylphenoxy)-1,3,5-triazine |
|---|---|
| PubChem CID | 4289842 |
| Molecular Formula | C36H45N3O3 |
| Molecular Weight | 567.77 g/mol |
| Exact Mass | 567.35 |
| IUPAC Name | 2,4,6-tris(4-tert-butyl-2-methylphenoxy)-1,3,5-triazine |
| SMILES | Cc1cc(C(C)(C)C)ccc1Oc1nc(Oc2ccc(C(C)(C)C)cc2C)nc(Oc2ccc(C(C)(C)C)cc2C)n1 |
| InChI | InChI=1S/C36H45N3O3/c1-22-19-25(34(4,5)6)13-16-28(22)40-31-37-32(41-29-17-14-26(20-23(29)2)35(7,8)9)39-33(38-31)42-30-18-15-27(21-24(30)3)36(10,11)12/h13-21H,1-12H3 |
| InChIKey | CHVIIYANXCUMIT-UHFFFAOYSA-N |
| XLogP | 10.07 |
| TPSA | 66.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.77 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |