C21H24FNO4 — CID 42898534
(5-fluoro-2-methoxyphenyl)methyl 2-benzamido-3-methylpentanoate (PubChem CID 42898534) has the molecular formula C21H24FNO4 and a molecular weight of 373.42 g/mol. Its IUPAC name is (5-fluoro-2-methoxyphenyl)methyl 2-benzamido-3-methylpentanoate.
| Compound Name | (5-fluoro-2-methoxyphenyl)methyl 2-benzamido-3-methylpentanoate |
|---|---|
| PubChem CID | 42898534 |
| Molecular Formula | C21H24FNO4 |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | (5-fluoro-2-methoxyphenyl)methyl 2-benzamido-3-methylpentanoate |
| SMILES | CCC(C)C(NC(=O)c1ccccc1)C(=O)OCc1cc(F)ccc1OC |
| InChI | InChI=1S/C21H24FNO4/c1-4-14(2)19(23-20(24)15-8-6-5-7-9-15)21(25)27-13-16-12-17(22)10-11-18(16)26-3/h5-12,14,19H,4,13H2,1-3H3,(H,23,24) |
| InChIKey | VTNXNKWNOZRDCL-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |