C21H16N4OS2 — CID 42900165
2-[(1-prop-2-enylbenzimidazol-2-yl)sulfanylmethyl]pyrimido[2,1-b][1,3]benzothiazol-4-one (PubChem CID 42900165) has the molecular formula C21H16N4OS2 and a molecular weight of 404.52 g/mol. Its IUPAC name is 2-[(1-prop-2-enylbenzimidazol-2-yl)sulfanylmethyl]pyrimido[2,1-b][1,3]benzothiazol-4-one.
| Compound Name | 2-[(1-prop-2-enylbenzimidazol-2-yl)sulfanylmethyl]pyrimido[2,1-b][1,3]benzothiazol-4-one |
|---|---|
| PubChem CID | 42900165 |
| Molecular Formula | C21H16N4OS2 |
| Molecular Weight | 404.52 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | 2-[(1-prop-2-enylbenzimidazol-2-yl)sulfanylmethyl]pyrimido[2,1-b][1,3]benzothiazol-4-one |
| SMILES | C=CCn1c(SCc2cc(=O)n3c(n2)sc2ccccc23)nc2ccccc21 |
| InChI | InChI=1S/C21H16N4OS2/c1-2-11-24-16-8-4-3-7-15(16)23-20(24)27-13-14-12-19(26)25-17-9-5-6-10-18(17)28-21(25)22-14/h2-10,12H,1,11,13H2 |
| InChIKey | SIRINASLXPUCRC-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 52.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.52 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|