C18H24N2O4 — CID 42900565
[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl] 4-acetamidobenzoate (PubChem CID 42900565) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is [2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl] 4-acetamidobenzoate.
| Compound Name | [2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl] 4-acetamidobenzoate |
|---|---|
| PubChem CID | 42900565 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | [2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl] 4-acetamidobenzoate |
| SMILES | CC(=O)Nc1ccc(C(=O)OCC(=O)N2C(C)CCCC2C)cc1 |
| InChI | InChI=1S/C18H24N2O4/c1-12-5-4-6-13(2)20(12)17(22)11-24-18(23)15-7-9-16(10-8-15)19-14(3)21/h7-10,12-13H,4-6,11H2,1-3H3,(H,19,21) |
| InChIKey | JRQBIGDBPYRCEK-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |