C23H26N2O4 — CID 42901071
[1-(1-adamantyl)-1-oxopropan-2-yl] 4-[(2-cyanoacetyl)amino]benzoate (PubChem CID 42901071) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is [1-(1-adamantyl)-1-oxopropan-2-yl] 4-[(2-cyanoacetyl)amino]benzoate.
| Compound Name | [1-(1-adamantyl)-1-oxopropan-2-yl] 4-[(2-cyanoacetyl)amino]benzoate |
|---|---|
| PubChem CID | 42901071 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | [1-(1-adamantyl)-1-oxopropan-2-yl] 4-[(2-cyanoacetyl)amino]benzoate |
| SMILES | CC(OC(=O)c1ccc(NC(=O)CC#N)cc1)C(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H26N2O4/c1-14(21(27)23-11-15-8-16(12-23)10-17(9-15)13-23)29-22(28)18-2-4-19(5-3-18)25-20(26)6-7-24/h2-5,14-17H,6,8-13H2,1H3,(H,25,26) |
| InChIKey | QWFIUHUYAJRSLB-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |