C26H31N5O3S — CID 42902193
2-[[5-[(3-methylphenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-morpholin-4-ylphenyl)propanamide (PubChem CID 42902193) has the molecular formula C26H31N5O3S and a molecular weight of 493.63 g/mol. Its IUPAC name is 2-[[5-[(3-methylphenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-morpholin-4-ylphenyl)propanamide.
| Compound Name | 2-[[5-[(3-methylphenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-morpholin-4-ylphenyl)propanamide |
|---|---|
| PubChem CID | 42902193 |
| Molecular Formula | C26H31N5O3S |
| Molecular Weight | 493.63 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | 2-[[5-[(3-methylphenoxy)methyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-morpholin-4-ylphenyl)propanamide |
| SMILES | C=CCn1c(COc2cccc(C)c2)nnc1SC(C)C(=O)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C26H31N5O3S/c1-4-12-31-24(18-34-23-7-5-6-19(2)17-23)28-29-26(31)35-20(3)25(32)27-21-8-10-22(11-9-21)30-13-15-33-16-14-30/h4-11,17,20H,1,12-16,18H2,2-3H3,(H,27,32) |
| InChIKey | GNJANCJNBGALPC-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.63 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|