C19H28N2O4S — CID 42903335
[2-(butan-2-ylamino)-2-oxoethyl] 2-[(3-methylbenzoyl)amino]-4-methylsulfanylbutanoate (PubChem CID 42903335) has the molecular formula C19H28N2O4S and a molecular weight of 380.51 g/mol. Its IUPAC name is [2-(butan-2-ylamino)-2-oxoethyl] 2-[(3-methylbenzoyl)amino]-4-methylsulfanylbutanoate.
| Compound Name | [2-(butan-2-ylamino)-2-oxoethyl] 2-[(3-methylbenzoyl)amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 42903335 |
| Molecular Formula | C19H28N2O4S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | [2-(butan-2-ylamino)-2-oxoethyl] 2-[(3-methylbenzoyl)amino]-4-methylsulfanylbutanoate |
| SMILES | CCC(C)NC(=O)COC(=O)C(CCSC)NC(=O)c1cccc(C)c1 |
| InChI | InChI=1S/C19H28N2O4S/c1-5-14(3)20-17(22)12-25-19(24)16(9-10-26-4)21-18(23)15-8-6-7-13(2)11-15/h6-8,11,14,16H,5,9-10,12H2,1-4H3,(H,20,22)(H,21,23) |
| InChIKey | VTNOLBVJCCCLPI-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |