About (2-oxocyclohexyl) 2-[(2,4-dichlorobenzoyl)amino]-3-methylbutanoate
(2-oxocyclohexyl) 2-[(2,4-dichlorobenzoyl)amino]-3-methylbutanoate (PubChem CID 42903349) has the molecular formula C18H21Cl2NO4
and a molecular weight of 386.28 g/mol. Its IUPAC name is (2-oxocyclohexyl) 2-[(2,4-dichlorobenzoyl)amino]-3-methylbutanoate.
Molecular Properties
| Compound Name | (2-oxocyclohexyl) 2-[(2,4-dichlorobenzoyl)amino]-3-methylbutanoate |
| PubChem CID | 42903349 |
| Molecular Formula | C18H21Cl2NO4 |
| Molecular Weight | 386.28 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | (2-oxocyclohexyl) 2-[(2,4-dichlorobenzoyl)amino]-3-methylbutanoate |
| SMILES | CC(C)C(NC(=O)c1ccc(Cl)cc1Cl)C(=O)OC1CCCCC1=O |
| InChI | InChI=1S/C18H21Cl2NO4/c1-10(2)16(18(24)25-15-6-4-3-5-14(15)22)21-17(23)12-8-7-11(19)9-13(12)20/h7-10,15-16H,3-6H2,1-2H3,(H,21,23) |
| InChIKey | XNIKTQVCFXMUDT-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.28 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-oxocyclohexyl) 2-[(2,4-dichlorobenzoyl)amino]-3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxocyclohexyl) 2-[(2,4-dichlorobenzoyl)amino]-3-methylbutanoate?
The IUPAC name of (2-oxocyclohexyl) 2-[(2,4-dichlorobenzoyl)amino]-3-methylbutanoate (CID 42903349) is (2-oxocyclohexyl) 2-[(2,4-dichlorobenzoyl)amino]-3-methylbutanoate.
What is the SMILES notation for (2-oxocyclohexyl) 2-[(2,4-dichlorobenzoyl)amino]-3-methylbutanoate?
The canonical SMILES for (2-oxocyclohexyl) 2-[(2,4-dichlorobenzoyl)amino]-3-methylbutanoate is CC(C)C(NC(=O)c1ccc(Cl)cc1Cl)C(=O)OC1CCCCC1=O.
What is the InChIKey of (2-oxocyclohexyl) 2-[(2,4-dichlorobenzoyl)amino]-3-methylbutanoate?
The InChIKey is XNIKTQVCFXMUDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21Cl2NO4/c1-10(2)16(18(24)25-15-6-4-3-5-14(15)22)21-17(23)12-8-7-11(19)9-13(12)20/h7-10,15-16H,3-6H2,1-2H3,(H,21,23).
What are the key properties of (2-oxocyclohexyl) 2-[(2,4-dichlorobenzoyl)amino]-3-methylbutanoate?
(2-oxocyclohexyl) 2-[(2,4-dichlorobenzoyl)amino]-3-methylbutanoate has a molecular weight of 386.28 g/mol, XLogP of 3.80, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxocyclohexyl) 2-[(2,4-dichlorobenzoyl)amino]-3-methylbutanoate is sourced from PubChem (CID 42903349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).