About N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)bicyclo[2.2.1]hept-5-ene-2-carboxamide
N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 42904821) has the molecular formula C15H15N3O2
and a molecular weight of 269.30 g/mol. Its IUPAC name is N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)bicyclo[2.2.1]hept-5-ene-2-carboxamide.
Molecular Properties
| Compound Name | N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| PubChem CID | 42904821 |
| Molecular Formula | C15H15N3O2 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | O=C(Nc1ccc2[nH]c(=O)[nH]c2c1)C1CC2C=CC1C2 |
| InChI | InChI=1S/C15H15N3O2/c19-14(11-6-8-1-2-9(11)5-8)16-10-3-4-12-13(7-10)18-15(20)17-12/h1-4,7-9,11H,5-6H2,(H,16,19)(H2,17,18,20) |
| InChIKey | DBCZPPMLGSTRBB-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)bicyclo[2.2.1]hept-5-ene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)bicyclo[2.2.1]hept-5-ene-2-carboxamide?
The IUPAC name of N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)bicyclo[2.2.1]hept-5-ene-2-carboxamide (CID 42904821) is N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)bicyclo[2.2.1]hept-5-ene-2-carboxamide.
What is the SMILES notation for N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)bicyclo[2.2.1]hept-5-ene-2-carboxamide?
The canonical SMILES for N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)bicyclo[2.2.1]hept-5-ene-2-carboxamide is O=C(Nc1ccc2[nH]c(=O)[nH]c2c1)C1CC2C=CC1C2.
What is the InChIKey of N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)bicyclo[2.2.1]hept-5-ene-2-carboxamide?
The InChIKey is DBCZPPMLGSTRBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N3O2/c19-14(11-6-8-1-2-9(11)5-8)16-10-3-4-12-13(7-10)18-15(20)17-12/h1-4,7-9,11H,5-6H2,(H,16,19)(H2,17,18,20).
What are the key properties of N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)bicyclo[2.2.1]hept-5-ene-2-carboxamide?
N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)bicyclo[2.2.1]hept-5-ene-2-carboxamide has a molecular weight of 269.30 g/mol, XLogP of 2.01, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)bicyclo[2.2.1]hept-5-ene-2-carboxamide is sourced from PubChem (CID 42904821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).