C18H21N3O2S2 — CID 42905619
7a-methyl-3-[2-(2-methylphenyl)imino-1,3-thiazolidine-3-carbonyl]-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazol-5-one (PubChem CID 42905619) has the molecular formula C18H21N3O2S2 and a molecular weight of 375.52 g/mol. Its IUPAC name is 7a-methyl-3-[2-(2-methylphenyl)imino-1,3-thiazolidine-3-carbonyl]-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazol-5-one.
| Compound Name | 7a-methyl-3-[2-(2-methylphenyl)imino-1,3-thiazolidine-3-carbonyl]-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazol-5-one |
|---|---|
| PubChem CID | 42905619 |
| Molecular Formula | C18H21N3O2S2 |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | 7a-methyl-3-[2-(2-methylphenyl)imino-1,3-thiazolidine-3-carbonyl]-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazol-5-one |
| SMILES | Cc1ccccc1/N=C1\SCCN1C(=O)C1CSC2(C)CCC(=O)N12 |
| InChI | InChI=1S/C18H21N3O2S2/c1-12-5-3-4-6-13(12)19-17-20(9-10-24-17)16(23)14-11-25-18(2)8-7-15(22)21(14)18/h3-6,14H,7-11H2,1-2H3/b19-17- |
| InChIKey | BSTZCPZBKYLTHV-ZPHPHTNESA-N |
| XLogP | 3.01 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|