C20H22N2O6S — CID 42905906
N-(1,3-benzodioxol-5-yl)-3-(2,6-dimethylmorpholin-4-yl)sulfonylbenzamide (PubChem CID 42905906) has the molecular formula C20H22N2O6S and a molecular weight of 418.47 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-3-(2,6-dimethylmorpholin-4-yl)sulfonylbenzamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-3-(2,6-dimethylmorpholin-4-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 42905906 |
| Molecular Formula | C20H22N2O6S |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-3-(2,6-dimethylmorpholin-4-yl)sulfonylbenzamide |
| SMILES | CC1CN(S(=O)(=O)c2cccc(C(=O)Nc3ccc4c(c3)OCO4)c2)CC(C)O1 |
| InChI | InChI=1S/C20H22N2O6S/c1-13-10-22(11-14(2)28-13)29(24,25)17-5-3-4-15(8-17)20(23)21-16-6-7-18-19(9-16)27-12-26-18/h3-9,13-14H,10-12H2,1-2H3,(H,21,23) |
| InChIKey | DYKOWXITPJOMMK-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |