C18H14Cl2N4O2S2 — CID 42906271
3-[2-[2-(3,4-dichlorophenyl)imino-5-methyl-1,3-thiazolidin-3-yl]-2-oxoethyl]thieno[2,3-d]pyrimidin-4-one (PubChem CID 42906271) has the molecular formula C18H14Cl2N4O2S2 and a molecular weight of 453.38 g/mol. Its IUPAC name is 3-[2-[2-(3,4-dichlorophenyl)imino-5-methyl-1,3-thiazolidin-3-yl]-2-oxoethyl]thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 3-[2-[2-(3,4-dichlorophenyl)imino-5-methyl-1,3-thiazolidin-3-yl]-2-oxoethyl]thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 42906271 |
| Molecular Formula | C18H14Cl2N4O2S2 |
| Molecular Weight | 453.38 g/mol |
| Exact Mass | 451.99 |
| IUPAC Name | 3-[2-[2-(3,4-dichlorophenyl)imino-5-methyl-1,3-thiazolidin-3-yl]-2-oxoethyl]thieno[2,3-d]pyrimidin-4-one |
| SMILES | CC1CN(C(=O)Cn2cnc3sccc3c2=O)/C(=N/c2ccc(Cl)c(Cl)c2)S1 |
| InChI | InChI=1S/C18H14Cl2N4O2S2/c1-10-7-24(18(28-10)22-11-2-3-13(19)14(20)6-11)15(25)8-23-9-21-16-12(17(23)26)4-5-27-16/h2-6,9-10H,7-8H2,1H3/b22-18- |
| InChIKey | VVBUCEHBZLJADQ-PYCFMQQDSA-N |
| XLogP | 4.42 |
| TPSA | 67.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.38 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|