C20H22BrN3O4 — CID 42906327
N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-3-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)propanamide (PubChem CID 42906327) has the molecular formula C20H22BrN3O4 and a molecular weight of 448.32 g/mol. Its IUPAC name is N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-3-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)propanamide.
| Compound Name | N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-3-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 42906327 |
| Molecular Formula | C20H22BrN3O4 |
| Molecular Weight | 448.32 g/mol |
| Exact Mass | 447.08 |
| IUPAC Name | N-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-3-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)propanamide |
| SMILES | Cc1cc(Br)ccc1NC(=O)CNC(=O)CCN1C(=O)C2CC=CCC2C1=O |
| InChI | InChI=1S/C20H22BrN3O4/c1-12-10-13(21)6-7-16(12)23-18(26)11-22-17(25)8-9-24-19(27)14-4-2-3-5-15(14)20(24)28/h2-3,6-7,10,14-15H,4-5,8-9,11H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | MHILWUFOOLFWPA-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.32 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|