About 2-methyl-N-[4-(1,3-thiazol-2-yl)phenyl]pentanamide
2-methyl-N-[4-(1,3-thiazol-2-yl)phenyl]pentanamide (PubChem CID 42907148) has the molecular formula C15H18N2OS
and a molecular weight of 274.39 g/mol. Its IUPAC name is 2-methyl-N-[4-(1,3-thiazol-2-yl)phenyl]pentanamide.
Molecular Properties
| Compound Name | 2-methyl-N-[4-(1,3-thiazol-2-yl)phenyl]pentanamide |
| PubChem CID | 42907148 |
| Molecular Formula | C15H18N2OS |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 2-methyl-N-[4-(1,3-thiazol-2-yl)phenyl]pentanamide |
| SMILES | CCCC(C)C(=O)Nc1ccc(-c2nccs2)cc1 |
| InChI | InChI=1S/C15H18N2OS/c1-3-4-11(2)14(18)17-13-7-5-12(6-8-13)15-16-9-10-19-15/h5-11H,3-4H2,1-2H3,(H,17,18) |
| InChIKey | MAPQTNTXANJZJP-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-N-[4-(1,3-thiazol-2-yl)phenyl]pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-[4-(1,3-thiazol-2-yl)phenyl]pentanamide?
The IUPAC name of 2-methyl-N-[4-(1,3-thiazol-2-yl)phenyl]pentanamide (CID 42907148) is 2-methyl-N-[4-(1,3-thiazol-2-yl)phenyl]pentanamide.
What is the SMILES notation for 2-methyl-N-[4-(1,3-thiazol-2-yl)phenyl]pentanamide?
The canonical SMILES for 2-methyl-N-[4-(1,3-thiazol-2-yl)phenyl]pentanamide is CCCC(C)C(=O)Nc1ccc(-c2nccs2)cc1.
What is the InChIKey of 2-methyl-N-[4-(1,3-thiazol-2-yl)phenyl]pentanamide?
The InChIKey is MAPQTNTXANJZJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2OS/c1-3-4-11(2)14(18)17-13-7-5-12(6-8-13)15-16-9-10-19-15/h5-11H,3-4H2,1-2H3,(H,17,18).
What are the key properties of 2-methyl-N-[4-(1,3-thiazol-2-yl)phenyl]pentanamide?
2-methyl-N-[4-(1,3-thiazol-2-yl)phenyl]pentanamide has a molecular weight of 274.39 g/mol, XLogP of 4.18, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-[4-(1,3-thiazol-2-yl)phenyl]pentanamide is sourced from PubChem (CID 42907148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).