C14H16ClNO3S — CID 42907796
N-(2-chloro-5-methylsulfonylphenyl)cyclohex-3-ene-1-carboxamide (PubChem CID 42907796) has the molecular formula C14H16ClNO3S and a molecular weight of 313.81 g/mol. Its IUPAC name is N-(2-chloro-5-methylsulfonylphenyl)cyclohex-3-ene-1-carboxamide.
| Compound Name | N-(2-chloro-5-methylsulfonylphenyl)cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 42907796 |
| Molecular Formula | C14H16ClNO3S |
| Molecular Weight | 313.81 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | N-(2-chloro-5-methylsulfonylphenyl)cyclohex-3-ene-1-carboxamide |
| SMILES | CS(=O)(=O)c1ccc(Cl)c(NC(=O)C2CC=CCC2)c1 |
| InChI | InChI=1S/C14H16ClNO3S/c1-20(18,19)11-7-8-12(15)13(9-11)16-14(17)10-5-3-2-4-6-10/h2-3,7-10H,4-6H2,1H3,(H,16,17) |
| InChIKey | UTAAVDPKWCJQCO-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.81 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|