C25H23IN4O4S — CID 42908761
3-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-methylsulfamoyl]-N-(4-iodophenyl)benzamide (PubChem CID 42908761) has the molecular formula C25H23IN4O4S and a molecular weight of 602.45 g/mol. Its IUPAC name is 3-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-methylsulfamoyl]-N-(4-iodophenyl)benzamide.
| Compound Name | 3-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-methylsulfamoyl]-N-(4-iodophenyl)benzamide |
|---|---|
| PubChem CID | 42908761 |
| Molecular Formula | C25H23IN4O4S |
| Molecular Weight | 602.45 g/mol |
| Exact Mass | 602.05 |
| IUPAC Name | 3-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-methylsulfamoyl]-N-(4-iodophenyl)benzamide |
| SMILES | Cc1c(N(C)S(=O)(=O)c2cccc(C(=O)Nc3ccc(I)cc3)c2)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C25H23IN4O4S/c1-17-23(25(32)30(28(17)2)21-9-5-4-6-10-21)29(3)35(33,34)22-11-7-8-18(16-22)24(31)27-20-14-12-19(26)13-15-20/h4-16H,1-3H3,(H,27,31) |
| InChIKey | SZLFQLCUIMDJBX-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 93.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.45 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|