C33H23Cl2F5N2O6 — CID 4290952
6a,9a-dichloro-2-(4-ethylphenyl)-6-[5-(hydroxymethyl)furan-2-yl]-8-(2,3,4,5,6-pentafluorophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4290952) has the molecular formula C33H23Cl2F5N2O6 and a molecular weight of 709.45 g/mol. Its IUPAC name is 6a,9a-dichloro-2-(4-ethylphenyl)-6-[5-(hydroxymethyl)furan-2-yl]-8-(2,3,4,5,6-pentafluorophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 6a,9a-dichloro-2-(4-ethylphenyl)-6-[5-(hydroxymethyl)furan-2-yl]-8-(2,3,4,5,6-pentafluorophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4290952 |
| Molecular Formula | C33H23Cl2F5N2O6 |
| Molecular Weight | 709.45 g/mol |
| Exact Mass | 708.09 |
| IUPAC Name | 6a,9a-dichloro-2-(4-ethylphenyl)-6-[5-(hydroxymethyl)furan-2-yl]-8-(2,3,4,5,6-pentafluorophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | CCc1ccc(N2C(=O)C3CC=C4C(CC5(Cl)C(=O)N(c6c(F)c(F)c(F)c(F)c6F)C(=O)C5(Cl)C4c4ccc(CO)o4)C3C2=O)cc1 |
| InChI | InChI=1S/C33H23Cl2F5N2O6/c1-2-13-3-5-14(6-4-13)41-28(44)17-9-8-16-18(20(17)29(41)45)11-32(34)30(46)42(27-25(39)23(37)22(36)24(38)26(27)40)31(47)33(32,35)21(16)19-10-7-15(12-43)48-19/h3-8,10,17-18,20-21,43H,2,9,11-12H2,1H3 |
| InChIKey | NHXJBNKVMDRPSA-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.45 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|