About 4-(5-fluoro-2,3-dihydroindol-1-yl)-4-oxo-N-(2-oxothiolan-3-yl)butanamide
4-(5-fluoro-2,3-dihydroindol-1-yl)-4-oxo-N-(2-oxothiolan-3-yl)butanamide (PubChem CID 4291033) has the molecular formula C16H17FN2O3S
and a molecular weight of 336.39 g/mol. Its IUPAC name is 4-(5-fluoro-2,3-dihydroindol-1-yl)-4-oxo-N-(2-oxothiolan-3-yl)butanamide.
Molecular Properties
| Compound Name | 4-(5-fluoro-2,3-dihydroindol-1-yl)-4-oxo-N-(2-oxothiolan-3-yl)butanamide |
| PubChem CID | 4291033 |
| Molecular Formula | C16H17FN2O3S |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 4-(5-fluoro-2,3-dihydroindol-1-yl)-4-oxo-N-(2-oxothiolan-3-yl)butanamide |
| SMILES | O=C(CCC(=O)N1CCc2cc(F)ccc21)NC1CCSC1=O |
| InChI | InChI=1S/C16H17FN2O3S/c17-11-1-2-13-10(9-11)5-7-19(13)15(21)4-3-14(20)18-12-6-8-23-16(12)22/h1-2,9,12H,3-8H2,(H,18,20) |
| InChIKey | ZWNSKARKWDFNII-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 4-(5-fluoro-2,3-dihydroindol-1-yl)-4-oxo-N-(2-oxothiolan-3-yl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-fluoro-2,3-dihydroindol-1-yl)-4-oxo-N-(2-oxothiolan-3-yl)butanamide?
The IUPAC name of 4-(5-fluoro-2,3-dihydroindol-1-yl)-4-oxo-N-(2-oxothiolan-3-yl)butanamide (CID 4291033) is 4-(5-fluoro-2,3-dihydroindol-1-yl)-4-oxo-N-(2-oxothiolan-3-yl)butanamide.
What is the SMILES notation for 4-(5-fluoro-2,3-dihydroindol-1-yl)-4-oxo-N-(2-oxothiolan-3-yl)butanamide?
The canonical SMILES for 4-(5-fluoro-2,3-dihydroindol-1-yl)-4-oxo-N-(2-oxothiolan-3-yl)butanamide is O=C(CCC(=O)N1CCc2cc(F)ccc21)NC1CCSC1=O.
What is the InChIKey of 4-(5-fluoro-2,3-dihydroindol-1-yl)-4-oxo-N-(2-oxothiolan-3-yl)butanamide?
The InChIKey is ZWNSKARKWDFNII-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17FN2O3S/c17-11-1-2-13-10(9-11)5-7-19(13)15(21)4-3-14(20)18-12-6-8-23-16(12)22/h1-2,9,12H,3-8H2,(H,18,20).
What are the key properties of 4-(5-fluoro-2,3-dihydroindol-1-yl)-4-oxo-N-(2-oxothiolan-3-yl)butanamide?
4-(5-fluoro-2,3-dihydroindol-1-yl)-4-oxo-N-(2-oxothiolan-3-yl)butanamide has a molecular weight of 336.39 g/mol, XLogP of 1.64, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-fluoro-2,3-dihydroindol-1-yl)-4-oxo-N-(2-oxothiolan-3-yl)butanamide is sourced from PubChem (CID 4291033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).