C20H30N4O3S — CID 42910897
1-[[4-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethoxy]benzoyl]amino]-3-propan-2-ylthiourea (PubChem CID 42910897) has the molecular formula C20H30N4O3S and a molecular weight of 406.55 g/mol. Its IUPAC name is 1-[[4-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethoxy]benzoyl]amino]-3-propan-2-ylthiourea.
| Compound Name | 1-[[4-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethoxy]benzoyl]amino]-3-propan-2-ylthiourea |
|---|---|
| PubChem CID | 42910897 |
| Molecular Formula | C20H30N4O3S |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | 1-[[4-[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethoxy]benzoyl]amino]-3-propan-2-ylthiourea |
| SMILES | CC(C)NC(=S)NNC(=O)c1ccc(OCC(=O)N2C(C)CCCC2C)cc1 |
| InChI | InChI=1S/C20H30N4O3S/c1-13(2)21-20(28)23-22-19(26)16-8-10-17(11-9-16)27-12-18(25)24-14(3)6-5-7-15(24)4/h8-11,13-15H,5-7,12H2,1-4H3,(H,22,26)(H2,21,23,28) |
| InChIKey | OMCHSANHZWACDG-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|