C17H22F2N4O4S — CID 42911216
3-[[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]methyl]-5-propylimidazolidine-2,4-dione (PubChem CID 42911216) has the molecular formula C17H22F2N4O4S and a molecular weight of 416.45 g/mol. Its IUPAC name is 3-[[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]methyl]-5-propylimidazolidine-2,4-dione.
| Compound Name | 3-[[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]methyl]-5-propylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 42911216 |
| Molecular Formula | C17H22F2N4O4S |
| Molecular Weight | 416.45 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 3-[[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]methyl]-5-propylimidazolidine-2,4-dione |
| SMILES | CCCC1NC(=O)N(CN2CCN(S(=O)(=O)c3c(F)cccc3F)CC2)C1=O |
| InChI | InChI=1S/C17H22F2N4O4S/c1-2-4-14-16(24)23(17(25)20-14)11-21-7-9-22(10-8-21)28(26,27)15-12(18)5-3-6-13(15)19/h3,5-6,14H,2,4,7-11H2,1H3,(H,20,25) |
| InChIKey | IHZHEVIOOSLHMU-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.45 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|