C27H25ClN2O5 — CID 42911487
N-(3-chloro-9,10-dioxoanthracen-2-yl)-2-[(3,4-dimethoxyphenyl)methyl-methylamino]propanamide (PubChem CID 42911487) has the molecular formula C27H25ClN2O5 and a molecular weight of 492.96 g/mol. Its IUPAC name is N-(3-chloro-9,10-dioxoanthracen-2-yl)-2-[(3,4-dimethoxyphenyl)methyl-methylamino]propanamide.
| Compound Name | N-(3-chloro-9,10-dioxoanthracen-2-yl)-2-[(3,4-dimethoxyphenyl)methyl-methylamino]propanamide |
|---|---|
| PubChem CID | 42911487 |
| Molecular Formula | C27H25ClN2O5 |
| Molecular Weight | 492.96 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | N-(3-chloro-9,10-dioxoanthracen-2-yl)-2-[(3,4-dimethoxyphenyl)methyl-methylamino]propanamide |
| SMILES | COc1ccc(CN(C)C(C)C(=O)Nc2cc3c(cc2Cl)C(=O)c2ccccc2C3=O)cc1OC |
| InChI | InChI=1S/C27H25ClN2O5/c1-15(30(2)14-16-9-10-23(34-3)24(11-16)35-4)27(33)29-22-13-20-19(12-21(22)28)25(31)17-7-5-6-8-18(17)26(20)32/h5-13,15H,14H2,1-4H3,(H,29,33) |
| InChIKey | WBEFQMUHRUJFQT-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.96 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|