C17H17FN2O5S2 — CID 42912416
4-ethoxy-N-[(E)-(6-fluoro-1,1-dioxo-2,3-dihydrothiochromen-4-ylidene)amino]benzenesulfonamide (PubChem CID 42912416) has the molecular formula C17H17FN2O5S2 and a molecular weight of 412.46 g/mol. Its IUPAC name is 4-ethoxy-N-[(E)-(6-fluoro-1,1-dioxo-2,3-dihydrothiochromen-4-ylidene)amino]benzenesulfonamide.
| Compound Name | 4-ethoxy-N-[(E)-(6-fluoro-1,1-dioxo-2,3-dihydrothiochromen-4-ylidene)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 42912416 |
| Molecular Formula | C17H17FN2O5S2 |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | 4-ethoxy-N-[(E)-(6-fluoro-1,1-dioxo-2,3-dihydrothiochromen-4-ylidene)amino]benzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)N/N=C2\CCS(=O)(=O)c3ccc(F)cc32)cc1 |
| InChI | InChI=1S/C17H17FN2O5S2/c1-2-25-13-4-6-14(7-5-13)27(23,24)20-19-16-9-10-26(21,22)17-8-3-12(18)11-15(16)17/h3-8,11,20H,2,9-10H2,1H3/b19-16+ |
| InChIKey | AIOGLQGMWXKIAI-KNTRCKAVSA-N |
| XLogP | 2.08 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|