About N-[3,5-bis(trifluoromethyl)phenyl]-4-(trifluoromethyl)benzenesulfonamide
N-[3,5-bis(trifluoromethyl)phenyl]-4-(trifluoromethyl)benzenesulfonamide (PubChem CID 42913167) has the molecular formula C15H8F9NO2S
and a molecular weight of 437.28 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]-4-(trifluoromethyl)benzenesulfonamide.
Molecular Properties
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]-4-(trifluoromethyl)benzenesulfonamide |
| PubChem CID | 42913167 |
| Molecular Formula | C15H8F9NO2S |
| Molecular Weight | 437.28 g/mol |
| Exact Mass | 437.01 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-4-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H8F9NO2S/c16-13(17,18)8-1-3-12(4-2-8)28(26,27)25-11-6-9(14(19,20)21)5-10(7-11)15(22,23)24/h1-7,25H |
| InChIKey | XWIMTSBJNRIAGD-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 437.28 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[3,5-bis(trifluoromethyl)phenyl]-4-(trifluoromethyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3,5-bis(trifluoromethyl)phenyl]-4-(trifluoromethyl)benzenesulfonamide?
The IUPAC name of N-[3,5-bis(trifluoromethyl)phenyl]-4-(trifluoromethyl)benzenesulfonamide (CID 42913167) is N-[3,5-bis(trifluoromethyl)phenyl]-4-(trifluoromethyl)benzenesulfonamide.
What is the SMILES notation for N-[3,5-bis(trifluoromethyl)phenyl]-4-(trifluoromethyl)benzenesulfonamide?
The canonical SMILES for N-[3,5-bis(trifluoromethyl)phenyl]-4-(trifluoromethyl)benzenesulfonamide is O=S(=O)(Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccc(C(F)(F)F)cc1.
What is the InChIKey of N-[3,5-bis(trifluoromethyl)phenyl]-4-(trifluoromethyl)benzenesulfonamide?
The InChIKey is XWIMTSBJNRIAGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H8F9NO2S/c16-13(17,18)8-1-3-12(4-2-8)28(26,27)25-11-6-9(14(19,20)21)5-10(7-11)15(22,23)24/h1-7,25H.
What are the key properties of N-[3,5-bis(trifluoromethyl)phenyl]-4-(trifluoromethyl)benzenesulfonamide?
N-[3,5-bis(trifluoromethyl)phenyl]-4-(trifluoromethyl)benzenesulfonamide has a molecular weight of 437.28 g/mol, XLogP of 5.54, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3,5-bis(trifluoromethyl)phenyl]-4-(trifluoromethyl)benzenesulfonamide is sourced from PubChem (CID 42913167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).