C17H24Cl2N2O — CID 42913403
2-[cyclohexyl(methyl)amino]-N-[1-(3,4-dichlorophenyl)ethyl]acetamide (PubChem CID 42913403) has the molecular formula C17H24Cl2N2O and a molecular weight of 343.30 g/mol. Its IUPAC name is 2-[cyclohexyl(methyl)amino]-N-[1-(3,4-dichlorophenyl)ethyl]acetamide.
| Compound Name | 2-[cyclohexyl(methyl)amino]-N-[1-(3,4-dichlorophenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 42913403 |
| Molecular Formula | C17H24Cl2N2O |
| Molecular Weight | 343.30 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 2-[cyclohexyl(methyl)amino]-N-[1-(3,4-dichlorophenyl)ethyl]acetamide |
| SMILES | CC(NC(=O)CN(C)C1CCCCC1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H24Cl2N2O/c1-12(13-8-9-15(18)16(19)10-13)20-17(22)11-21(2)14-6-4-3-5-7-14/h8-10,12,14H,3-7,11H2,1-2H3,(H,20,22) |
| InChIKey | RKSCDTCXFMBOAF-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.30 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |