About N-(1,1-dioxothiolan-3-yl)-2-(methylamino)acetamide;hydrochloride
N-(1,1-dioxothiolan-3-yl)-2-(methylamino)acetamide;hydrochloride (PubChem CID 42913513) has the molecular formula C7H15ClN2O3S
and a molecular weight of 242.73 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2-(methylamino)acetamide;hydrochloride.
Molecular Properties
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2-(methylamino)acetamide;hydrochloride |
| PubChem CID | 42913513 |
| Molecular Formula | C7H15ClN2O3S |
| Molecular Weight | 242.73 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2-(methylamino)acetamide;hydrochloride |
| SMILES | CNCC(=O)NC1CCS(=O)(=O)C1.Cl |
| InChI | InChI=1S/C7H14N2O3S.ClH/c1-8-4-7(10)9-6-2-3-13(11,12)5-6;/h6,8H,2-5H2,1H3,(H,9,10);1H |
| InChIKey | NPGYQYGJZBDLOZ-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.73 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(1,1-dioxothiolan-3-yl)-2-(methylamino)acetamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,1-dioxothiolan-3-yl)-2-(methylamino)acetamide;hydrochloride?
The IUPAC name of N-(1,1-dioxothiolan-3-yl)-2-(methylamino)acetamide;hydrochloride (CID 42913513) is N-(1,1-dioxothiolan-3-yl)-2-(methylamino)acetamide;hydrochloride.
What is the SMILES notation for N-(1,1-dioxothiolan-3-yl)-2-(methylamino)acetamide;hydrochloride?
The canonical SMILES for N-(1,1-dioxothiolan-3-yl)-2-(methylamino)acetamide;hydrochloride is CNCC(=O)NC1CCS(=O)(=O)C1.Cl.
What is the InChIKey of N-(1,1-dioxothiolan-3-yl)-2-(methylamino)acetamide;hydrochloride?
The InChIKey is NPGYQYGJZBDLOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2O3S.ClH/c1-8-4-7(10)9-6-2-3-13(11,12)5-6;/h6,8H,2-5H2,1H3,(H,9,10);1H.
What are the key properties of N-(1,1-dioxothiolan-3-yl)-2-(methylamino)acetamide;hydrochloride?
N-(1,1-dioxothiolan-3-yl)-2-(methylamino)acetamide;hydrochloride has a molecular weight of 242.73 g/mol, XLogP of -1.07, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,1-dioxothiolan-3-yl)-2-(methylamino)acetamide;hydrochloride is sourced from PubChem (CID 42913513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).