C26H34N2O3S — CID 42913620
2-[benzhydryl(methyl)amino]-N-cyclohexyl-N-(1,1-dioxothiolan-3-yl)acetamide (PubChem CID 42913620) has the molecular formula C26H34N2O3S and a molecular weight of 454.64 g/mol. Its IUPAC name is 2-[benzhydryl(methyl)amino]-N-cyclohexyl-N-(1,1-dioxothiolan-3-yl)acetamide.
| Compound Name | 2-[benzhydryl(methyl)amino]-N-cyclohexyl-N-(1,1-dioxothiolan-3-yl)acetamide |
|---|---|
| PubChem CID | 42913620 |
| Molecular Formula | C26H34N2O3S |
| Molecular Weight | 454.64 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | 2-[benzhydryl(methyl)amino]-N-cyclohexyl-N-(1,1-dioxothiolan-3-yl)acetamide |
| SMILES | CN(CC(=O)N(C1CCCCC1)C1CCS(=O)(=O)C1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H34N2O3S/c1-27(26(21-11-5-2-6-12-21)22-13-7-3-8-14-22)19-25(29)28(23-15-9-4-10-16-23)24-17-18-32(30,31)20-24/h2-3,5-8,11-14,23-24,26H,4,9-10,15-20H2,1H3 |
| InChIKey | VOZHQVUZDSOFFQ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.64 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |