C23H31N3O3S2 — CID 42913997
2-[4-(4-butan-2-ylphenyl)sulfonylpiperazin-1-yl]-N-(2-methylsulfanylphenyl)acetamide (PubChem CID 42913997) has the molecular formula C23H31N3O3S2 and a molecular weight of 461.65 g/mol. Its IUPAC name is 2-[4-(4-butan-2-ylphenyl)sulfonylpiperazin-1-yl]-N-(2-methylsulfanylphenyl)acetamide.
| Compound Name | 2-[4-(4-butan-2-ylphenyl)sulfonylpiperazin-1-yl]-N-(2-methylsulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 42913997 |
| Molecular Formula | C23H31N3O3S2 |
| Molecular Weight | 461.65 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | 2-[4-(4-butan-2-ylphenyl)sulfonylpiperazin-1-yl]-N-(2-methylsulfanylphenyl)acetamide |
| SMILES | CCC(C)c1ccc(S(=O)(=O)N2CCN(CC(=O)Nc3ccccc3SC)CC2)cc1 |
| InChI | InChI=1S/C23H31N3O3S2/c1-4-18(2)19-9-11-20(12-10-19)31(28,29)26-15-13-25(14-16-26)17-23(27)24-21-7-5-6-8-22(21)30-3/h5-12,18H,4,13-17H2,1-3H3,(H,24,27) |
| InChIKey | ZVMVEGKDCHMJOZ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.65 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |