C24H23FN2O3S — CID 4291445
3-acetamido-N-[(2-ethoxyphenyl)methyl]-4-(4-fluorophenyl)sulfanylbenzamide (PubChem CID 4291445) has the molecular formula C24H23FN2O3S and a molecular weight of 438.52 g/mol. Its IUPAC name is 3-acetamido-N-[(2-ethoxyphenyl)methyl]-4-(4-fluorophenyl)sulfanylbenzamide.
| Compound Name | 3-acetamido-N-[(2-ethoxyphenyl)methyl]-4-(4-fluorophenyl)sulfanylbenzamide |
|---|---|
| PubChem CID | 4291445 |
| Molecular Formula | C24H23FN2O3S |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | 3-acetamido-N-[(2-ethoxyphenyl)methyl]-4-(4-fluorophenyl)sulfanylbenzamide |
| SMILES | CCOc1ccccc1CNC(=O)c1ccc(Sc2ccc(F)cc2)c(NC(C)=O)c1 |
| InChI | InChI=1S/C24H23FN2O3S/c1-3-30-22-7-5-4-6-18(22)15-26-24(29)17-8-13-23(21(14-17)27-16(2)28)31-20-11-9-19(25)10-12-20/h4-14H,3,15H2,1-2H3,(H,26,29)(H,27,28) |
| InChIKey | JUXVICMVWWTCSO-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |