C11H17N5S — CID 42914743
2-[(E)-(5-piperidin-1-ylthiophen-2-yl)methylideneamino]guanidine (PubChem CID 42914743) has the molecular formula C11H17N5S and a molecular weight of 251.36 g/mol. Its IUPAC name is 2-[(E)-(5-piperidin-1-ylthiophen-2-yl)methylideneamino]guanidine.
| Compound Name | 2-[(E)-(5-piperidin-1-ylthiophen-2-yl)methylideneamino]guanidine |
|---|---|
| PubChem CID | 42914743 |
| Molecular Formula | C11H17N5S |
| Molecular Weight | 251.36 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 2-[(E)-(5-piperidin-1-ylthiophen-2-yl)methylideneamino]guanidine |
| SMILES | NC(N)=N/N=C/c1ccc(N2CCCCC2)s1 |
| InChI | InChI=1S/C11H17N5S/c12-11(13)15-14-8-9-4-5-10(17-9)16-6-2-1-3-7-16/h4-5,8H,1-3,6-7H2,(H4,12,13,15)/b14-8+ |
| InChIKey | RNMRORUYGNOFLX-RIYZIHGNSA-N |
| XLogP | 1.35 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.36 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|