About N-(3-methyl-1,1-dioxothiolan-3-yl)-2-thiophen-2-ylacetamide
N-(3-methyl-1,1-dioxothiolan-3-yl)-2-thiophen-2-ylacetamide (PubChem CID 42915503) has the molecular formula C11H15NO3S2
and a molecular weight of 273.38 g/mol. Its IUPAC name is N-(3-methyl-1,1-dioxothiolan-3-yl)-2-thiophen-2-ylacetamide.
Molecular Properties
| Compound Name | N-(3-methyl-1,1-dioxothiolan-3-yl)-2-thiophen-2-ylacetamide |
| PubChem CID | 42915503 |
| Molecular Formula | C11H15NO3S2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | N-(3-methyl-1,1-dioxothiolan-3-yl)-2-thiophen-2-ylacetamide |
| SMILES | CC1(NC(=O)Cc2cccs2)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H15NO3S2/c1-11(4-6-17(14,15)8-11)12-10(13)7-9-3-2-5-16-9/h2-3,5H,4,6-8H2,1H3,(H,12,13) |
| InChIKey | SZYWTMMLKDOPAW-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(3-methyl-1,1-dioxothiolan-3-yl)-2-thiophen-2-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-methyl-1,1-dioxothiolan-3-yl)-2-thiophen-2-ylacetamide?
The IUPAC name of N-(3-methyl-1,1-dioxothiolan-3-yl)-2-thiophen-2-ylacetamide (CID 42915503) is N-(3-methyl-1,1-dioxothiolan-3-yl)-2-thiophen-2-ylacetamide.
What is the SMILES notation for N-(3-methyl-1,1-dioxothiolan-3-yl)-2-thiophen-2-ylacetamide?
The canonical SMILES for N-(3-methyl-1,1-dioxothiolan-3-yl)-2-thiophen-2-ylacetamide is CC1(NC(=O)Cc2cccs2)CCS(=O)(=O)C1.
What is the InChIKey of N-(3-methyl-1,1-dioxothiolan-3-yl)-2-thiophen-2-ylacetamide?
The InChIKey is SZYWTMMLKDOPAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO3S2/c1-11(4-6-17(14,15)8-11)12-10(13)7-9-3-2-5-16-9/h2-3,5H,4,6-8H2,1H3,(H,12,13).
What are the key properties of N-(3-methyl-1,1-dioxothiolan-3-yl)-2-thiophen-2-ylacetamide?
N-(3-methyl-1,1-dioxothiolan-3-yl)-2-thiophen-2-ylacetamide has a molecular weight of 273.38 g/mol, XLogP of 0.98, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-methyl-1,1-dioxothiolan-3-yl)-2-thiophen-2-ylacetamide is sourced from PubChem (CID 42915503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).