About 2-(piperazin-1-ylmethyl)-1,3-benzothiazole;dihydrochloride
2-(piperazin-1-ylmethyl)-1,3-benzothiazole;dihydrochloride (PubChem CID 42917049) has the molecular formula C12H17Cl2N3S
and a molecular weight of 306.26 g/mol. Its IUPAC name is 2-(piperazin-1-ylmethyl)-1,3-benzothiazole;dihydrochloride.
Molecular Properties
| Compound Name | 2-(piperazin-1-ylmethyl)-1,3-benzothiazole;dihydrochloride |
| PubChem CID | 42917049 |
| Molecular Formula | C12H17Cl2N3S |
| Molecular Weight | 306.26 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 2-(piperazin-1-ylmethyl)-1,3-benzothiazole;dihydrochloride |
| SMILES | Cl.Cl.c1ccc2sc(CN3CCNCC3)nc2c1 |
| InChI | InChI=1S/C12H15N3S.2ClH/c1-2-4-11-10(3-1)14-12(16-11)9-15-7-5-13-6-8-15;;/h1-4,13H,5-9H2;2*1H |
| InChIKey | SANHMEMTMIYEFM-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.26 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(piperazin-1-ylmethyl)-1,3-benzothiazole;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(piperazin-1-ylmethyl)-1,3-benzothiazole;dihydrochloride?
The IUPAC name of 2-(piperazin-1-ylmethyl)-1,3-benzothiazole;dihydrochloride (CID 42917049) is 2-(piperazin-1-ylmethyl)-1,3-benzothiazole;dihydrochloride.
What is the SMILES notation for 2-(piperazin-1-ylmethyl)-1,3-benzothiazole;dihydrochloride?
The canonical SMILES for 2-(piperazin-1-ylmethyl)-1,3-benzothiazole;dihydrochloride is Cl.Cl.c1ccc2sc(CN3CCNCC3)nc2c1.
What is the InChIKey of 2-(piperazin-1-ylmethyl)-1,3-benzothiazole;dihydrochloride?
The InChIKey is SANHMEMTMIYEFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3S.2ClH/c1-2-4-11-10(3-1)14-12(16-11)9-15-7-5-13-6-8-15;;/h1-4,13H,5-9H2;2*1H.
What are the key properties of 2-(piperazin-1-ylmethyl)-1,3-benzothiazole;dihydrochloride?
2-(piperazin-1-ylmethyl)-1,3-benzothiazole;dihydrochloride has a molecular weight of 306.26 g/mol, XLogP of 2.55, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(piperazin-1-ylmethyl)-1,3-benzothiazole;dihydrochloride is sourced from PubChem (CID 42917049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).