About 1-(3,4-dichlorophenyl)sulfonylpiperazine;hydrochloride
1-(3,4-dichlorophenyl)sulfonylpiperazine;hydrochloride (PubChem CID 42917377) has the molecular formula C10H13Cl3N2O2S
and a molecular weight of 331.65 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)sulfonylpiperazine;hydrochloride.
Molecular Properties
| Compound Name | 1-(3,4-dichlorophenyl)sulfonylpiperazine;hydrochloride |
| PubChem CID | 42917377 |
| Molecular Formula | C10H13Cl3N2O2S |
| Molecular Weight | 331.65 g/mol |
| Exact Mass | 329.98 |
| IUPAC Name | 1-(3,4-dichlorophenyl)sulfonylpiperazine;hydrochloride |
| SMILES | Cl.O=S(=O)(c1ccc(Cl)c(Cl)c1)N1CCNCC1 |
| InChI | InChI=1S/C10H12Cl2N2O2S.ClH/c11-9-2-1-8(7-10(9)12)17(15,16)14-5-3-13-4-6-14;/h1-2,7,13H,3-6H2;1H |
| InChIKey | RQHDVDKMNZZWCE-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.65 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(3,4-dichlorophenyl)sulfonylpiperazine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-dichlorophenyl)sulfonylpiperazine;hydrochloride?
The IUPAC name of 1-(3,4-dichlorophenyl)sulfonylpiperazine;hydrochloride (CID 42917377) is 1-(3,4-dichlorophenyl)sulfonylpiperazine;hydrochloride.
What is the SMILES notation for 1-(3,4-dichlorophenyl)sulfonylpiperazine;hydrochloride?
The canonical SMILES for 1-(3,4-dichlorophenyl)sulfonylpiperazine;hydrochloride is Cl.O=S(=O)(c1ccc(Cl)c(Cl)c1)N1CCNCC1.
What is the InChIKey of 1-(3,4-dichlorophenyl)sulfonylpiperazine;hydrochloride?
The InChIKey is RQHDVDKMNZZWCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12Cl2N2O2S.ClH/c11-9-2-1-8(7-10(9)12)17(15,16)14-5-3-13-4-6-14;/h1-2,7,13H,3-6H2;1H.
What are the key properties of 1-(3,4-dichlorophenyl)sulfonylpiperazine;hydrochloride?
1-(3,4-dichlorophenyl)sulfonylpiperazine;hydrochloride has a molecular weight of 331.65 g/mol, XLogP of 2.01, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-dichlorophenyl)sulfonylpiperazine;hydrochloride is sourced from PubChem (CID 42917377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).