About 2-imidazol-1-ylpropanoic acid;hydrochloride
2-imidazol-1-ylpropanoic acid;hydrochloride (PubChem CID 42917415) has the molecular formula C6H9ClN2O2
and a molecular weight of 176.60 g/mol. Its IUPAC name is 2-imidazol-1-ylpropanoic acid;hydrochloride.
Molecular Properties
| Compound Name | 2-imidazol-1-ylpropanoic acid;hydrochloride |
| PubChem CID | 42917415 |
| Molecular Formula | C6H9ClN2O2 |
| Molecular Weight | 176.60 g/mol |
| Exact Mass | 176.04 |
| IUPAC Name | 2-imidazol-1-ylpropanoic acid;hydrochloride |
| SMILES | CC(C(=O)O)n1ccnc1.Cl |
| InChI | InChI=1S/C6H8N2O2.ClH/c1-5(6(9)10)8-3-2-7-4-8;/h2-5H,1H3,(H,9,10);1H |
| InChIKey | KPMNIMWDXWDUCS-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.60 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-imidazol-1-ylpropanoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-imidazol-1-ylpropanoic acid;hydrochloride?
The IUPAC name of 2-imidazol-1-ylpropanoic acid;hydrochloride (CID 42917415) is 2-imidazol-1-ylpropanoic acid;hydrochloride.
What is the SMILES notation for 2-imidazol-1-ylpropanoic acid;hydrochloride?
The canonical SMILES for 2-imidazol-1-ylpropanoic acid;hydrochloride is CC(C(=O)O)n1ccnc1.Cl.
What is the InChIKey of 2-imidazol-1-ylpropanoic acid;hydrochloride?
The InChIKey is KPMNIMWDXWDUCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O2.ClH/c1-5(6(9)10)8-3-2-7-4-8;/h2-5H,1H3,(H,9,10);1H.
What are the key properties of 2-imidazol-1-ylpropanoic acid;hydrochloride?
2-imidazol-1-ylpropanoic acid;hydrochloride has a molecular weight of 176.60 g/mol, XLogP of 0.95, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-imidazol-1-ylpropanoic acid;hydrochloride is sourced from PubChem (CID 42917415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).