C26H22ClN3O5 — CID 42918405
2-[4-(1,3-benzodioxol-5-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[(4-chlorophenyl)-phenylmethyl]acetamide (PubChem CID 42918405) has the molecular formula C26H22ClN3O5 and a molecular weight of 491.93 g/mol. Its IUPAC name is 2-[4-(1,3-benzodioxol-5-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[(4-chlorophenyl)-phenylmethyl]acetamide.
| Compound Name | 2-[4-(1,3-benzodioxol-5-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[(4-chlorophenyl)-phenylmethyl]acetamide |
|---|---|
| PubChem CID | 42918405 |
| Molecular Formula | C26H22ClN3O5 |
| Molecular Weight | 491.93 g/mol |
| Exact Mass | 491.12 |
| IUPAC Name | 2-[4-(1,3-benzodioxol-5-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-[(4-chlorophenyl)-phenylmethyl]acetamide |
| SMILES | CC1(c2ccc3c(c2)OCO3)NC(=O)N(CC(=O)NC(c2ccccc2)c2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C26H22ClN3O5/c1-26(18-9-12-20-21(13-18)35-15-34-20)24(32)30(25(33)29-26)14-22(31)28-23(16-5-3-2-4-6-16)17-7-10-19(27)11-8-17/h2-13,23H,14-15H2,1H3,(H,28,31)(H,29,33) |
| InChIKey | LUXCMHVGVSOTBV-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.93 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|