C16H21NO5S — CID 42918494
(2-oxocyclohexyl) 3-[4-(methylsulfamoyl)phenyl]propanoate (PubChem CID 42918494) has the molecular formula C16H21NO5S and a molecular weight of 339.41 g/mol. Its IUPAC name is (2-oxocyclohexyl) 3-[4-(methylsulfamoyl)phenyl]propanoate.
| Compound Name | (2-oxocyclohexyl) 3-[4-(methylsulfamoyl)phenyl]propanoate |
|---|---|
| PubChem CID | 42918494 |
| Molecular Formula | C16H21NO5S |
| Molecular Weight | 339.41 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | (2-oxocyclohexyl) 3-[4-(methylsulfamoyl)phenyl]propanoate |
| SMILES | CNS(=O)(=O)c1ccc(CCC(=O)OC2CCCCC2=O)cc1 |
| InChI | InChI=1S/C16H21NO5S/c1-17-23(20,21)13-9-6-12(7-10-13)8-11-16(19)22-15-5-3-2-4-14(15)18/h6-7,9-10,15,17H,2-5,8,11H2,1H3 |
| InChIKey | GRBMCTMRWOIFJU-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.41 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |