C26H27NO7 — CID 42918529
(7-hydroxy-2-oxochromen-4-yl)methyl 1-butyl-2-(4-methoxyphenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 42918529) has the molecular formula C26H27NO7 and a molecular weight of 465.50 g/mol. Its IUPAC name is (7-hydroxy-2-oxochromen-4-yl)methyl 1-butyl-2-(4-methoxyphenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | (7-hydroxy-2-oxochromen-4-yl)methyl 1-butyl-2-(4-methoxyphenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 42918529 |
| Molecular Formula | C26H27NO7 |
| Molecular Weight | 465.50 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | (7-hydroxy-2-oxochromen-4-yl)methyl 1-butyl-2-(4-methoxyphenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | CCCCN1C(=O)CC(C(=O)OCc2cc(=O)oc3cc(O)ccc23)C1c1ccc(OC)cc1 |
| InChI | InChI=1S/C26H27NO7/c1-3-4-11-27-23(29)14-21(25(27)16-5-8-19(32-2)9-6-16)26(31)33-15-17-12-24(30)34-22-13-18(28)7-10-20(17)22/h5-10,12-13,21,25,28H,3-4,11,14-15H2,1-2H3 |
| InChIKey | CREGNHKHFVWZDL-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 106.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.50 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|