C21H29N3O6S — CID 42919151
methyl 5-[2-[3-(dimethylsulfamoyl)-4-ethoxyanilino]propanoyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate (PubChem CID 42919151) has the molecular formula C21H29N3O6S and a molecular weight of 451.55 g/mol. Its IUPAC name is methyl 5-[2-[3-(dimethylsulfamoyl)-4-ethoxyanilino]propanoyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate.
| Compound Name | methyl 5-[2-[3-(dimethylsulfamoyl)-4-ethoxyanilino]propanoyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 42919151 |
| Molecular Formula | C21H29N3O6S |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | methyl 5-[2-[3-(dimethylsulfamoyl)-4-ethoxyanilino]propanoyl]-2,4-dimethyl-1H-pyrrole-3-carboxylate |
| SMILES | CCOc1ccc(NC(C)C(=O)c2[nH]c(C)c(C(=O)OC)c2C)cc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C21H29N3O6S/c1-8-30-16-10-9-15(11-17(16)31(27,28)24(5)6)22-14(4)20(25)19-12(2)18(13(3)23-19)21(26)29-7/h9-11,14,22-23H,8H2,1-7H3 |
| InChIKey | KGLOXEJFMHKFMZ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 117.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|