C21H26N4O5S — CID 42919344
N-[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxamide (PubChem CID 42919344) has the molecular formula C21H26N4O5S and a molecular weight of 446.53 g/mol. Its IUPAC name is N-[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxamide.
| Compound Name | N-[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxamide |
|---|---|
| PubChem CID | 42919344 |
| Molecular Formula | C21H26N4O5S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | N-[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-7-carboxamide |
| SMILES | COc1ccc(C(CNC(=O)C2=CN3CCS(=O)(=O)N=C3C=C2)N2CCOCC2)cc1 |
| InChI | InChI=1S/C21H26N4O5S/c1-29-18-5-2-16(3-6-18)19(24-8-11-30-12-9-24)14-22-21(26)17-4-7-20-23-31(27,28)13-10-25(20)15-17/h2-7,15,19H,8-14H2,1H3,(H,22,26) |
| InChIKey | HDPIJYMCSZPNDX-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |