About 4-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl]-2,6-dimethylmorpholine
4-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl]-2,6-dimethylmorpholine (PubChem CID 42919545) has the molecular formula C14H18N2O3
and a molecular weight of 262.31 g/mol. Its IUPAC name is 4-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl]-2,6-dimethylmorpholine.
Molecular Properties
| Compound Name | 4-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl]-2,6-dimethylmorpholine |
| PubChem CID | 42919545 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 4-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl]-2,6-dimethylmorpholine |
| SMILES | CC1CN(Cc2cc(-c3ccco3)on2)CC(C)O1 |
| InChI | InChI=1S/C14H18N2O3/c1-10-7-16(8-11(2)18-10)9-12-6-14(19-15-12)13-4-3-5-17-13/h3-6,10-11H,7-9H2,1-2H3 |
| InChIKey | KXXGJGFNXHDUGK-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 51.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl]-2,6-dimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl]-2,6-dimethylmorpholine?
The IUPAC name of 4-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl]-2,6-dimethylmorpholine (CID 42919545) is 4-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl]-2,6-dimethylmorpholine.
What is the SMILES notation for 4-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl]-2,6-dimethylmorpholine?
The canonical SMILES for 4-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl]-2,6-dimethylmorpholine is CC1CN(Cc2cc(-c3ccco3)on2)CC(C)O1.
What is the InChIKey of 4-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl]-2,6-dimethylmorpholine?
The InChIKey is KXXGJGFNXHDUGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O3/c1-10-7-16(8-11(2)18-10)9-12-6-14(19-15-12)13-4-3-5-17-13/h3-6,10-11H,7-9H2,1-2H3.
What are the key properties of 4-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl]-2,6-dimethylmorpholine?
4-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl]-2,6-dimethylmorpholine has a molecular weight of 262.31 g/mol, XLogP of 2.54, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[5-(furan-2-yl)-1,2-oxazol-3-yl]methyl]-2,6-dimethylmorpholine is sourced from PubChem (CID 42919545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).