C21H13F5OS — CID 4292055
3-(2,3,4,5,6-pentafluorophenyl)sulfanyl-1-(4-phenylphenyl)propan-1-one (PubChem CID 4292055) has the molecular formula C21H13F5OS and a molecular weight of 408.39 g/mol. Its IUPAC name is 3-(2,3,4,5,6-pentafluorophenyl)sulfanyl-1-(4-phenylphenyl)propan-1-one.
| Compound Name | 3-(2,3,4,5,6-pentafluorophenyl)sulfanyl-1-(4-phenylphenyl)propan-1-one |
|---|---|
| PubChem CID | 4292055 |
| Molecular Formula | C21H13F5OS |
| Molecular Weight | 408.39 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | 3-(2,3,4,5,6-pentafluorophenyl)sulfanyl-1-(4-phenylphenyl)propan-1-one |
| SMILES | O=C(CCSc1c(F)c(F)c(F)c(F)c1F)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C21H13F5OS/c22-16-17(23)19(25)21(20(26)18(16)24)28-11-10-15(27)14-8-6-13(7-9-14)12-4-2-1-3-5-12/h1-9H,10-11H2 |
| InChIKey | MXUHXOGFVJDWPU-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.39 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|