C13H14Cl2N2O4S — CID 42921138
3-[(2,4-dichlorophenyl)methyl]-5-(2-methylsulfonylethyl)imidazolidine-2,4-dione (PubChem CID 42921138) has the molecular formula C13H14Cl2N2O4S and a molecular weight of 365.24 g/mol. Its IUPAC name is 3-[(2,4-dichlorophenyl)methyl]-5-(2-methylsulfonylethyl)imidazolidine-2,4-dione.
| Compound Name | 3-[(2,4-dichlorophenyl)methyl]-5-(2-methylsulfonylethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 42921138 |
| Molecular Formula | C13H14Cl2N2O4S |
| Molecular Weight | 365.24 g/mol |
| Exact Mass | 364.01 |
| IUPAC Name | 3-[(2,4-dichlorophenyl)methyl]-5-(2-methylsulfonylethyl)imidazolidine-2,4-dione |
| SMILES | CS(=O)(=O)CCC1NC(=O)N(Cc2ccc(Cl)cc2Cl)C1=O |
| InChI | InChI=1S/C13H14Cl2N2O4S/c1-22(20,21)5-4-11-12(18)17(13(19)16-11)7-8-2-3-9(14)6-10(8)15/h2-3,6,11H,4-5,7H2,1H3,(H,16,19) |
| InChIKey | AMADZIRPGWIELN-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.24 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|