About [1-(1-acetyl-2,3-dihydroindol-5-yl)-1-oxopropan-2-yl] 2-thiophen-3-ylacetate
[1-(1-acetyl-2,3-dihydroindol-5-yl)-1-oxopropan-2-yl] 2-thiophen-3-ylacetate (PubChem CID 42922144) has the molecular formula C19H19NO4S
and a molecular weight of 357.43 g/mol. Its IUPAC name is [1-(1-acetyl-2,3-dihydroindol-5-yl)-1-oxopropan-2-yl] 2-thiophen-3-ylacetate.
Molecular Properties
| Compound Name | [1-(1-acetyl-2,3-dihydroindol-5-yl)-1-oxopropan-2-yl] 2-thiophen-3-ylacetate |
| PubChem CID | 42922144 |
| Molecular Formula | C19H19NO4S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | [1-(1-acetyl-2,3-dihydroindol-5-yl)-1-oxopropan-2-yl] 2-thiophen-3-ylacetate |
| SMILES | CC(=O)N1CCc2cc(C(=O)C(C)OC(=O)Cc3ccsc3)ccc21 |
| InChI | InChI=1S/C19H19NO4S/c1-12(24-18(22)9-14-6-8-25-11-14)19(23)16-3-4-17-15(10-16)5-7-20(17)13(2)21/h3-4,6,8,10-12H,5,7,9H2,1-2H3 |
| InChIKey | JBURLGHNUKPDOM-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-(1-acetyl-2,3-dihydroindol-5-yl)-1-oxopropan-2-yl] 2-thiophen-3-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(1-acetyl-2,3-dihydroindol-5-yl)-1-oxopropan-2-yl] 2-thiophen-3-ylacetate?
The IUPAC name of [1-(1-acetyl-2,3-dihydroindol-5-yl)-1-oxopropan-2-yl] 2-thiophen-3-ylacetate (CID 42922144) is [1-(1-acetyl-2,3-dihydroindol-5-yl)-1-oxopropan-2-yl] 2-thiophen-3-ylacetate.
What is the SMILES notation for [1-(1-acetyl-2,3-dihydroindol-5-yl)-1-oxopropan-2-yl] 2-thiophen-3-ylacetate?
The canonical SMILES for [1-(1-acetyl-2,3-dihydroindol-5-yl)-1-oxopropan-2-yl] 2-thiophen-3-ylacetate is CC(=O)N1CCc2cc(C(=O)C(C)OC(=O)Cc3ccsc3)ccc21.
What is the InChIKey of [1-(1-acetyl-2,3-dihydroindol-5-yl)-1-oxopropan-2-yl] 2-thiophen-3-ylacetate?
The InChIKey is JBURLGHNUKPDOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19NO4S/c1-12(24-18(22)9-14-6-8-25-11-14)19(23)16-3-4-17-15(10-16)5-7-20(17)13(2)21/h3-4,6,8,10-12H,5,7,9H2,1-2H3.
What are the key properties of [1-(1-acetyl-2,3-dihydroindol-5-yl)-1-oxopropan-2-yl] 2-thiophen-3-ylacetate?
[1-(1-acetyl-2,3-dihydroindol-5-yl)-1-oxopropan-2-yl] 2-thiophen-3-ylacetate has a molecular weight of 357.43 g/mol, XLogP of 3.01, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(1-acetyl-2,3-dihydroindol-5-yl)-1-oxopropan-2-yl] 2-thiophen-3-ylacetate is sourced from PubChem (CID 42922144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).