About (8-methyl-2-oxo-4-phenylchromen-7-yl) 1-oxo-3,4-dihydroisochromene-3-carboxylate
(8-methyl-2-oxo-4-phenylchromen-7-yl) 1-oxo-3,4-dihydroisochromene-3-carboxylate (PubChem CID 42923081) has the molecular formula C26H18O6
and a molecular weight of 426.42 g/mol. Its IUPAC name is (8-methyl-2-oxo-4-phenylchromen-7-yl) 1-oxo-3,4-dihydroisochromene-3-carboxylate.
Molecular Properties
| Compound Name | (8-methyl-2-oxo-4-phenylchromen-7-yl) 1-oxo-3,4-dihydroisochromene-3-carboxylate |
| PubChem CID | 42923081 |
| Molecular Formula | C26H18O6 |
| Molecular Weight | 426.42 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | (8-methyl-2-oxo-4-phenylchromen-7-yl) 1-oxo-3,4-dihydroisochromene-3-carboxylate |
| SMILES | Cc1c(OC(=O)C2Cc3ccccc3C(=O)O2)ccc2c(-c3ccccc3)cc(=O)oc12 |
| InChI | InChI=1S/C26H18O6/c1-15-21(30-26(29)22-13-17-9-5-6-10-18(17)25(28)31-22)12-11-19-20(14-23(27)32-24(15)19)16-7-3-2-4-8-16/h2-12,14,22H,13H2,1H3 |
| InChIKey | QLKDWFTULIHJHT-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 82.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.42 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (8-methyl-2-oxo-4-phenylchromen-7-yl) 1-oxo-3,4-dihydroisochromene-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8-methyl-2-oxo-4-phenylchromen-7-yl) 1-oxo-3,4-dihydroisochromene-3-carboxylate?
The IUPAC name of (8-methyl-2-oxo-4-phenylchromen-7-yl) 1-oxo-3,4-dihydroisochromene-3-carboxylate (CID 42923081) is (8-methyl-2-oxo-4-phenylchromen-7-yl) 1-oxo-3,4-dihydroisochromene-3-carboxylate.
What is the SMILES notation for (8-methyl-2-oxo-4-phenylchromen-7-yl) 1-oxo-3,4-dihydroisochromene-3-carboxylate?
The canonical SMILES for (8-methyl-2-oxo-4-phenylchromen-7-yl) 1-oxo-3,4-dihydroisochromene-3-carboxylate is Cc1c(OC(=O)C2Cc3ccccc3C(=O)O2)ccc2c(-c3ccccc3)cc(=O)oc12.
What is the InChIKey of (8-methyl-2-oxo-4-phenylchromen-7-yl) 1-oxo-3,4-dihydroisochromene-3-carboxylate?
The InChIKey is QLKDWFTULIHJHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H18O6/c1-15-21(30-26(29)22-13-17-9-5-6-10-18(17)25(28)31-22)12-11-19-20(14-23(27)32-24(15)19)16-7-3-2-4-8-16/h2-12,14,22H,13H2,1H3.
What are the key properties of (8-methyl-2-oxo-4-phenylchromen-7-yl) 1-oxo-3,4-dihydroisochromene-3-carboxylate?
(8-methyl-2-oxo-4-phenylchromen-7-yl) 1-oxo-3,4-dihydroisochromene-3-carboxylate has a molecular weight of 426.42 g/mol, XLogP of 4.46, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (8-methyl-2-oxo-4-phenylchromen-7-yl) 1-oxo-3,4-dihydroisochromene-3-carboxylate is sourced from PubChem (CID 42923081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).